C12H12ClF3N4 — CID 103009998
6-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 103009998) has the molecular formula C12H12ClF3N4 and a molecular weight of 304.70 g/mol. Its IUPAC name is 6-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103009998 |
| Molecular Formula | C12H12ClF3N4 |
| Molecular Weight | 304.70 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 6-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cn1nccc1CCNc1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C12H12ClF3N4/c1-20-9(3-5-18-20)2-4-17-11-7-8(12(14,15)16)6-10(13)19-11/h3,5-7H,2,4H2,1H3,(H,17,19) |
| InChIKey | GOEUGJRBCZGGLP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|