C11H13ClN4 — CID 104695901
2-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]pyridin-4-amine (PubChem CID 104695901) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 104695901 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]pyridin-4-amine |
| SMILES | Cn1nccc1CCNc1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H13ClN4/c1-16-10(4-7-15-16)3-6-13-9-2-5-14-11(12)8-9/h2,4-5,7-8H,3,6H2,1H3,(H,13,14) |
| InChIKey | KMZGWNLMZHVRFL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|