C9H9ClN4S — CID 115000535
3-chloro-N-(2-thiophen-3-ylethyl)-1,2,4-triazin-5-amine (PubChem CID 115000535) has the molecular formula C9H9ClN4S and a molecular weight of 240.72 g/mol. Its IUPAC name is 3-chloro-N-(2-thiophen-3-ylethyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-chloro-N-(2-thiophen-3-ylethyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 115000535 |
| Molecular Formula | C9H9ClN4S |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 3-chloro-N-(2-thiophen-3-ylethyl)-1,2,4-triazin-5-amine |
| SMILES | Clc1nncc(NCCc2ccsc2)n1 |
| InChI | InChI=1S/C9H9ClN4S/c10-9-13-8(5-12-14-9)11-3-1-7-2-4-15-6-7/h2,4-6H,1,3H2,(H,11,13,14) |
| InChIKey | TVQXUKHEVSKCTD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |