C6H9ClN4O — CID 114998205
3-[(3-chloro-1,2,4-triazin-5-yl)amino]propan-1-ol (PubChem CID 114998205) has the molecular formula C6H9ClN4O and a molecular weight of 188.62 g/mol. Its IUPAC name is 3-[(3-chloro-1,2,4-triazin-5-yl)amino]propan-1-ol.
| Compound Name | 3-[(3-chloro-1,2,4-triazin-5-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 114998205 |
| Molecular Formula | C6H9ClN4O |
| Molecular Weight | 188.62 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 3-[(3-chloro-1,2,4-triazin-5-yl)amino]propan-1-ol |
| SMILES | OCCCNc1cnnc(Cl)n1 |
| InChI | InChI=1S/C6H9ClN4O/c7-6-10-5(4-9-11-6)8-2-1-3-12/h4,12H,1-3H2,(H,8,10,11) |
| InChIKey | ICZMVSPCVKSWSU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.62 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|