C8H11ClN2O — CID 29043106
3-[(5-chloro-2-pyridinyl)amino]propan-1-ol (PubChem CID 29043106) has the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. Its IUPAC name is 3-[(5-chloro-2-pyridinyl)amino]propan-1-ol.
| Compound Name | 3-[(5-chloro-2-pyridinyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 29043106 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 3-[(5-chloro-2-pyridinyl)amino]propan-1-ol |
| SMILES | OCCCNc1ccc(Cl)cn1 |
| InChI | InChI=1S/C8H11ClN2O/c9-7-2-3-8(11-6-7)10-4-1-5-12/h2-3,6,12H,1,4-5H2,(H,10,11) |
| InChIKey | XRIYHCLRIVVUFX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|