C11H19Cl2N3 — CID 110175206
2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride (PubChem CID 110175206) has the molecular formula C11H19Cl2N3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride.
| Compound Name | 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride |
|---|---|
| PubChem CID | 110175206 |
| Molecular Formula | C11H19Cl2N3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride |
| SMILES | CC[NH+](CC)CCNc1ccc(Cl)cn1.[Cl-] |
| InChI | InChI=1S/C11H18ClN3.ClH/c1-3-15(4-2)8-7-13-11-6-5-10(12)9-14-11;/h5-6,9H,3-4,7-8H2,1-2H3,(H,13,14);1H |
| InChIKey | MXZWVYNIGCICNF-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 29.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |