2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride

C11H19Cl2N3 — CID 110175206

IUPAC2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride
SMILESCC[NH+](CC)CCNc1ccc(Cl)cn1.[Cl-]
InChIInChI=1S/C11H18ClN3.ClH/c1-3-15(4-2)8-7-13-11-6-5-10(12)9-14-11;/h5-6,9H,3-4,7-8H2,1-2H3,(H,13,14);1H
InChIKeyMXZWVYNIGCICNF-UHFFFAOYSA-N
MW264.20 g/mol
LogP-1.92
Rot. Bonds6

About 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride

2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride (PubChem CID 110175206) has the molecular formula C11H19Cl2N3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride.

Molecular Properties

Compound Name2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride
PubChem CID110175206
Molecular FormulaC11H19Cl2N3
Molecular Weight264.20 g/mol
Exact Mass263.10
IUPAC Name2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride
SMILESCC[NH+](CC)CCNc1ccc(Cl)cn1.[Cl-]
InChIInChI=1S/C11H18ClN3.ClH/c1-3-15(4-2)8-7-13-11-6-5-10(12)9-14-11;/h5-6,9H,3-4,7-8H2,1-2H3,(H,13,14);1H
InChIKeyMXZWVYNIGCICNF-UHFFFAOYSA-N
XLogP-1.92
TPSA29.36 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.20
LogP ≤ 5-1.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride?
The IUPAC name of 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride (CID 110175206) is 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride.
What is the SMILES notation for 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride?
The canonical SMILES for 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride is CC[NH+](CC)CCNc1ccc(Cl)cn1.[Cl-].
What is the InChIKey of 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride?
The InChIKey is MXZWVYNIGCICNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClN3.ClH/c1-3-15(4-2)8-7-13-11-6-5-10(12)9-14-11;/h5-6,9H,3-4,7-8H2,1-2H3,(H,13,14);1H.
What are the key properties of 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride?
2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride has a molecular weight of 264.20 g/mol, XLogP of -1.92, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-2-pyridinyl)amino]ethyl-diethylazanium chloride is sourced from PubChem (CID 110175206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).