C14H15ClN2 — CID 54931106
5-chloro-N-(3-phenylpropyl)pyridin-2-amine (PubChem CID 54931106) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 5-chloro-N-(3-phenylpropyl)pyridin-2-amine.
| Compound Name | 5-chloro-N-(3-phenylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 54931106 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-chloro-N-(3-phenylpropyl)pyridin-2-amine |
| SMILES | Clc1ccc(NCCCc2ccccc2)nc1 |
| InChI | InChI=1S/C14H15ClN2/c15-13-8-9-14(17-11-13)16-10-4-7-12-5-2-1-3-6-12/h1-3,5-6,8-9,11H,4,7,10H2,(H,16,17) |
| InChIKey | ALOHMKKLTQGLES-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|