C14H14BrClN2 — CID 114835697
3-bromo-5-chloro-N-(3-phenylpropyl)pyridin-2-amine (PubChem CID 114835697) has the molecular formula C14H14BrClN2 and a molecular weight of 325.64 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-(3-phenylpropyl)pyridin-2-amine.
| Compound Name | 3-bromo-5-chloro-N-(3-phenylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114835697 |
| Molecular Formula | C14H14BrClN2 |
| Molecular Weight | 325.64 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3-bromo-5-chloro-N-(3-phenylpropyl)pyridin-2-amine |
| SMILES | Clc1cnc(NCCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C14H14BrClN2/c15-13-9-12(16)10-18-14(13)17-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2,(H,17,18) |
| InChIKey | KLWFKDJJQTVYNS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|