C15H14BrF3N2 — CID 106795999
5-bromo-N-(3-phenylpropyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106795999) has the molecular formula C15H14BrF3N2 and a molecular weight of 359.19 g/mol. Its IUPAC name is 5-bromo-N-(3-phenylpropyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(3-phenylpropyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106795999 |
| Molecular Formula | C15H14BrF3N2 |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 5-bromo-N-(3-phenylpropyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(Br)cnc1NCCCc1ccccc1 |
| InChI | InChI=1S/C15H14BrF3N2/c16-12-9-13(15(17,18)19)14(21-10-12)20-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2,(H,20,21) |
| InChIKey | XINGCUUSPREDNU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|