C11H11BrF3N5 — CID 106796222
5-bromo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106796222) has the molecular formula C11H11BrF3N5 and a molecular weight of 350.14 g/mol. Its IUPAC name is 5-bromo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106796222 |
| Molecular Formula | C11H11BrF3N5 |
| Molecular Weight | 350.14 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 5-bromo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(Br)cnc1NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H11BrF3N5/c12-7-4-8(11(13,14)15)10(17-5-7)16-3-1-2-9-18-6-19-20-9/h4-6H,1-3H2,(H,16,17)(H,18,19,20) |
| InChIKey | JMXAVFIJQWCEPO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|