C12H13F3N4 — CID 64532428
N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-(trifluoromethyl)aniline (PubChem CID 64532428) has the molecular formula C12H13F3N4 and a molecular weight of 270.26 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-(trifluoromethyl)aniline.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 64532428 |
| Molecular Formula | C12H13F3N4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccccc1NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H13F3N4/c13-12(14,15)9-4-1-2-5-10(9)16-7-3-6-11-17-8-18-19-11/h1-2,4-5,8,16H,3,6-7H2,(H,17,18,19) |
| InChIKey | DFAMTVGJHHWQTI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|