C11H14N4 — CID 61360611
2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline (PubChem CID 61360611) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline.
| Compound Name | 2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 61360611 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
| SMILES | Cc1ccccc1NCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H14N4/c1-9-4-2-3-5-10(9)12-7-6-11-13-8-14-15-11/h2-5,8,12H,6-7H2,1H3,(H,13,14,15) |
| InChIKey | BCRBBBUCNGIYAY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |