C12H18N6O2S — CID 107116378
2-amino-N,N-dimethyl-3-[2-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide (PubChem CID 107116378) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-3-[2-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide.
| Compound Name | 2-amino-N,N-dimethyl-3-[2-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 107116378 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-amino-N,N-dimethyl-3-[2-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NCCc2ncn[nH]2)c1N |
| InChI | InChI=1S/C12H18N6O2S/c1-18(2)21(19,20)10-5-3-4-9(12(10)13)14-7-6-11-15-8-16-17-11/h3-5,8,14H,6-7,13H2,1-2H3,(H,15,16,17) |
| InChIKey | BXHXBRHNUKZFTI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|