C10H15N3O4S — CID 107116230
2-[2-amino-3-(dimethylsulfamoyl)anilino]acetic acid (PubChem CID 107116230) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[2-amino-3-(dimethylsulfamoyl)anilino]acetic acid.
| Compound Name | 2-[2-amino-3-(dimethylsulfamoyl)anilino]acetic acid |
|---|---|
| PubChem CID | 107116230 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[2-amino-3-(dimethylsulfamoyl)anilino]acetic acid |
| SMILES | CN(C)S(=O)(=O)c1cccc(NCC(=O)O)c1N |
| InChI | InChI=1S/C10H15N3O4S/c1-13(2)18(16,17)8-5-3-4-7(10(8)11)12-6-9(14)15/h3-5,12H,6,11H2,1-2H3,(H,14,15) |
| InChIKey | KBJXFQSRQAXBEN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|