C12H21N3O4S2 — CID 107116170
2-amino-N,N-dimethyl-3-(3-methylsulfonylpropylamino)benzenesulfonamide (PubChem CID 107116170) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-3-(3-methylsulfonylpropylamino)benzenesulfonamide.
| Compound Name | 2-amino-N,N-dimethyl-3-(3-methylsulfonylpropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 107116170 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-amino-N,N-dimethyl-3-(3-methylsulfonylpropylamino)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NCCCS(C)(=O)=O)c1N |
| InChI | InChI=1S/C12H21N3O4S2/c1-15(2)21(18,19)11-7-4-6-10(12(11)13)14-8-5-9-20(3,16)17/h4,6-7,14H,5,8-9,13H2,1-3H3 |
| InChIKey | QETJRATUCKIPLI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|