C13H19N5O2S — CID 107116008
2-amino-N,N-dimethyl-3-(2-pyrazol-1-ylethylamino)benzenesulfonamide (PubChem CID 107116008) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-3-(2-pyrazol-1-ylethylamino)benzenesulfonamide.
| Compound Name | 2-amino-N,N-dimethyl-3-(2-pyrazol-1-ylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 107116008 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-amino-N,N-dimethyl-3-(2-pyrazol-1-ylethylamino)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NCCn2cccn2)c1N |
| InChI | InChI=1S/C13H19N5O2S/c1-17(2)21(19,20)12-6-3-5-11(13(12)14)15-8-10-18-9-4-7-16-18/h3-7,9,15H,8,10,14H2,1-2H3 |
| InChIKey | QMTINWDJBDODSS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|