C12H16N4O — CID 113392574
3-methoxy-1-N-(2-pyrazol-1-ylethyl)benzene-1,2-diamine (PubChem CID 113392574) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 3-methoxy-1-N-(2-pyrazol-1-ylethyl)benzene-1,2-diamine.
| Compound Name | 3-methoxy-1-N-(2-pyrazol-1-ylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 113392574 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3-methoxy-1-N-(2-pyrazol-1-ylethyl)benzene-1,2-diamine |
| SMILES | COc1cccc(NCCn2cccn2)c1N |
| InChI | InChI=1S/C12H16N4O/c1-17-11-5-2-4-10(12(11)13)14-7-9-16-8-3-6-15-16/h2-6,8,14H,7,9,13H2,1H3 |
| InChIKey | YUDBFCXZLOZKBO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|