C13H22N4O3S — CID 106095636
3-[2-amino-3-(dimethylsulfamoyl)anilino]-3-methylbutanamide (PubChem CID 106095636) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-[2-amino-3-(dimethylsulfamoyl)anilino]-3-methylbutanamide.
| Compound Name | 3-[2-amino-3-(dimethylsulfamoyl)anilino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106095636 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-[2-amino-3-(dimethylsulfamoyl)anilino]-3-methylbutanamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(C)(C)CC(N)=O)c1N |
| InChI | InChI=1S/C13H22N4O3S/c1-13(2,8-11(14)18)16-9-6-5-7-10(12(9)15)21(19,20)17(3)4/h5-7,16H,8,15H2,1-4H3,(H2,14,18) |
| InChIKey | FPBZJLYUPBRHPF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|