C15H19N3O2S — CID 107115709
2-amino-N,N-dimethyl-3-(4-methylanilino)benzenesulfonamide (PubChem CID 107115709) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-3-(4-methylanilino)benzenesulfonamide.
| Compound Name | 2-amino-N,N-dimethyl-3-(4-methylanilino)benzenesulfonamide |
|---|---|
| PubChem CID | 107115709 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-amino-N,N-dimethyl-3-(4-methylanilino)benzenesulfonamide |
| SMILES | Cc1ccc(Nc2cccc(S(=O)(=O)N(C)C)c2N)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-11-7-9-12(10-8-11)17-13-5-4-6-14(15(13)16)21(19,20)18(2)3/h4-10,17H,16H2,1-3H3 |
| InChIKey | YIXWAAZEUITWOB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|