C15H27N3O2S — CID 107116325
2-amino-3-(3-ethylpentan-2-ylamino)-N,N-dimethylbenzenesulfonamide (PubChem CID 107116325) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-amino-3-(3-ethylpentan-2-ylamino)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-amino-3-(3-ethylpentan-2-ylamino)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107116325 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-amino-3-(3-ethylpentan-2-ylamino)-N,N-dimethylbenzenesulfonamide |
| SMILES | CCC(CC)C(C)Nc1cccc(S(=O)(=O)N(C)C)c1N |
| InChI | InChI=1S/C15H27N3O2S/c1-6-12(7-2)11(3)17-13-9-8-10-14(15(13)16)21(19,20)18(4)5/h8-12,17H,6-7,16H2,1-5H3 |
| InChIKey | LANTZDOPJZIOAU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|