C12H16N4O2S — CID 64529869
2-ethylsulfonyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline (PubChem CID 64529869) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline.
| Compound Name | 2-ethylsulfonyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 64529869 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-ethylsulfonyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
| SMILES | CCS(=O)(=O)c1ccccc1NCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H16N4O2S/c1-2-19(17,18)11-6-4-3-5-10(11)13-8-7-12-14-9-15-16-12/h3-6,9,13H,2,7-8H2,1H3,(H,14,15,16) |
| InChIKey | KIZGTESSUFOOOE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |