C11H13N5O2 — CID 64532051
2-methyl-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline (PubChem CID 64532051) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline.
| Compound Name | 2-methyl-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 64532051 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-methyl-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H13N5O2/c1-8-2-3-9(16(17)18)6-10(8)12-5-4-11-13-7-14-15-11/h2-3,6-7,12H,4-5H2,1H3,(H,13,14,15) |
| InChIKey | NSERYLGSDUXTOD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|