C10H9F2N5O2 — CID 115507973
3,5-difluoro-2-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline (PubChem CID 115507973) has the molecular formula C10H9F2N5O2 and a molecular weight of 269.21 g/mol. Its IUPAC name is 3,5-difluoro-2-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline.
| Compound Name | 3,5-difluoro-2-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 115507973 |
| Molecular Formula | C10H9F2N5O2 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 3,5-difluoro-2-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
| SMILES | O=[N+]([O-])c1c(F)cc(F)cc1NCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H9F2N5O2/c11-6-3-7(12)10(17(18)19)8(4-6)13-2-1-9-14-5-15-16-9/h3-5,13H,1-2H2,(H,14,15,16) |
| InChIKey | XZJGYUQCTDHFQC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|