C9H10N6O2 — CID 64530676
4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine (PubChem CID 64530676) has the molecular formula C9H10N6O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine.
| Compound Name | 4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 64530676 |
| Molecular Formula | C9H10N6O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccnc(NCCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C9H10N6O2/c16-15(17)7-1-3-10-9(5-7)11-4-2-8-12-6-13-14-8/h1,3,5-6H,2,4H2,(H,10,11)(H,12,13,14) |
| InChIKey | YLZHZGYDHOJTMV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|