C10H10BrN5O2 — CID 65343052
5-bromo-2-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline (PubChem CID 65343052) has the molecular formula C10H10BrN5O2 and a molecular weight of 312.13 g/mol. Its IUPAC name is 5-bromo-2-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline.
| Compound Name | 5-bromo-2-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 65343052 |
| Molecular Formula | C10H10BrN5O2 |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 5-bromo-2-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1NCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H10BrN5O2/c11-7-1-2-9(16(17)18)8(5-7)12-4-3-10-13-6-14-15-10/h1-2,5-6,12H,3-4H2,(H,13,14,15) |
| InChIKey | JTSGCAIUVRJJRE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|