C12H12N6O2 — CID 64531252
3-nitro-4-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzonitrile (PubChem CID 64531252) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 3-nitro-4-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzonitrile.
| Compound Name | 3-nitro-4-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzonitrile |
|---|---|
| PubChem CID | 64531252 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-nitro-4-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCCCc2ncn[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N6O2/c13-7-9-3-4-10(11(6-9)18(19)20)14-5-1-2-12-15-8-16-17-12/h3-4,6,8,14H,1-2,5H2,(H,15,16,17) |
| InChIKey | KKDWPPUYKOZTPX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|