C12H11N5O2 — CID 78965596
4-[(2-methyl-1H-imidazol-5-yl)methylamino]-3-nitrobenzonitrile (PubChem CID 78965596) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-[(2-methyl-1H-imidazol-5-yl)methylamino]-3-nitrobenzonitrile.
| Compound Name | 4-[(2-methyl-1H-imidazol-5-yl)methylamino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 78965596 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-[(2-methyl-1H-imidazol-5-yl)methylamino]-3-nitrobenzonitrile |
| SMILES | Cc1ncc(CNc2ccc(C#N)cc2[N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C12H11N5O2/c1-8-14-6-10(16-8)7-15-11-3-2-9(5-13)4-12(11)17(18)19/h2-4,6,15H,7H2,1H3,(H,14,16) |
| InChIKey | YVTXFMQIRNRUJC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|