C14H19N3O2 — CID 78966756
3-nitro-4-(2,3,3-trimethylbutylamino)benzonitrile (PubChem CID 78966756) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-nitro-4-(2,3,3-trimethylbutylamino)benzonitrile.
| Compound Name | 3-nitro-4-(2,3,3-trimethylbutylamino)benzonitrile |
|---|---|
| PubChem CID | 78966756 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-nitro-4-(2,3,3-trimethylbutylamino)benzonitrile |
| SMILES | CC(CNc1ccc(C#N)cc1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C14H19N3O2/c1-10(14(2,3)4)9-16-12-6-5-11(8-15)7-13(12)17(18)19/h5-7,10,16H,9H2,1-4H3 |
| InChIKey | OEMJHMOHVLMKJJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|