C10H7F4N3O2 — CID 106293770
3-nitro-4-(2,2,3,3-tetrafluoropropylamino)benzonitrile (PubChem CID 106293770) has the molecular formula C10H7F4N3O2 and a molecular weight of 277.18 g/mol. Its IUPAC name is 3-nitro-4-(2,2,3,3-tetrafluoropropylamino)benzonitrile.
| Compound Name | 3-nitro-4-(2,2,3,3-tetrafluoropropylamino)benzonitrile |
|---|---|
| PubChem CID | 106293770 |
| Molecular Formula | C10H7F4N3O2 |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-nitro-4-(2,2,3,3-tetrafluoropropylamino)benzonitrile |
| SMILES | N#Cc1ccc(NCC(F)(F)C(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H7F4N3O2/c11-9(12)10(13,14)5-16-7-2-1-6(4-15)3-8(7)17(18)19/h1-3,9,16H,5H2 |
| InChIKey | CLKLFABSHNGSRP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|