C10H7F7N2O2 — CID 106293843
2-nitro-N-(2,2,3,3-tetrafluoropropyl)-4-(trifluoromethyl)aniline (PubChem CID 106293843) has the molecular formula C10H7F7N2O2 and a molecular weight of 320.16 g/mol. Its IUPAC name is 2-nitro-N-(2,2,3,3-tetrafluoropropyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-nitro-N-(2,2,3,3-tetrafluoropropyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 106293843 |
| Molecular Formula | C10H7F7N2O2 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-nitro-N-(2,2,3,3-tetrafluoropropyl)-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H7F7N2O2/c11-8(12)9(13,14)4-18-6-2-1-5(10(15,16)17)3-7(6)19(20)21/h1-3,8,18H,4H2 |
| InChIKey | NFHPGOKUDQKGKO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|