C8H6F3N3O4 — CID 54929661
2,4-dinitro-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 54929661) has the molecular formula C8H6F3N3O4 and a molecular weight of 265.15 g/mol. Its IUPAC name is 2,4-dinitro-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 2,4-dinitro-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 54929661 |
| Molecular Formula | C8H6F3N3O4 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2,4-dinitro-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(NCC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H6F3N3O4/c9-8(10,11)4-12-6-2-1-5(13(15)16)3-7(6)14(17)18/h1-3,12H,4H2 |
| InChIKey | HRMNVOFYBKXAKR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|