C11H13N3O6 — CID 115427614
3-(2,4-dinitroanilino)-2,2-dimethylpropanoic acid (PubChem CID 115427614) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is 3-(2,4-dinitroanilino)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(2,4-dinitroanilino)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 115427614 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-(2,4-dinitroanilino)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H13N3O6/c1-11(2,10(15)16)6-12-8-4-3-7(13(17)18)5-9(8)14(19)20/h3-5,12H,6H2,1-2H3,(H,15,16) |
| InChIKey | DZYVNFHYXWKVCY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|