C11H13FN2O4 — CID 113307936
3-(5-fluoro-2-nitroanilino)-2,2-dimethylpropanoic acid (PubChem CID 113307936) has the molecular formula C11H13FN2O4 and a molecular weight of 256.23 g/mol. Its IUPAC name is 3-(5-fluoro-2-nitroanilino)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(5-fluoro-2-nitroanilino)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 113307936 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-(5-fluoro-2-nitroanilino)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNc1cc(F)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H13FN2O4/c1-11(2,10(15)16)6-13-8-5-7(12)3-4-9(8)14(17)18/h3-5,13H,6H2,1-2H3,(H,15,16) |
| InChIKey | ZXAMPPHLQLNZDG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|