C11H12F2N2O4 — CID 115427624
3-(2,3-difluoro-6-nitroanilino)-2,2-dimethylpropanoic acid (PubChem CID 115427624) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is 3-(2,3-difluoro-6-nitroanilino)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(2,3-difluoro-6-nitroanilino)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 115427624 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-(2,3-difluoro-6-nitroanilino)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNc1c([N+](=O)[O-])ccc(F)c1F)C(=O)O |
| InChI | InChI=1S/C11H12F2N2O4/c1-11(2,10(16)17)5-14-9-7(15(18)19)4-3-6(12)8(9)13/h3-4,14H,5H2,1-2H3,(H,16,17) |
| InChIKey | NEWTURTXMVIMKD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|