C11H13F2N3O3 — CID 113410718
3-(2,3-difluoro-6-nitroanilino)-N-ethylpropanamide (PubChem CID 113410718) has the molecular formula C11H13F2N3O3 and a molecular weight of 273.24 g/mol. Its IUPAC name is 3-(2,3-difluoro-6-nitroanilino)-N-ethylpropanamide.
| Compound Name | 3-(2,3-difluoro-6-nitroanilino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 113410718 |
| Molecular Formula | C11H13F2N3O3 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-(2,3-difluoro-6-nitroanilino)-N-ethylpropanamide |
| SMILES | CCNC(=O)CCNc1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C11H13F2N3O3/c1-2-14-9(17)5-6-15-11-8(16(18)19)4-3-7(12)10(11)13/h3-4,15H,2,5-6H2,1H3,(H,14,17) |
| InChIKey | PUMJGCYXMNVNCE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|