C10H12F2N2O4S — CID 62532304
2,3-difluoro-N-(3-methylsulfonylpropyl)-6-nitroaniline (PubChem CID 62532304) has the molecular formula C10H12F2N2O4S and a molecular weight of 294.28 g/mol. Its IUPAC name is 2,3-difluoro-N-(3-methylsulfonylpropyl)-6-nitroaniline.
| Compound Name | 2,3-difluoro-N-(3-methylsulfonylpropyl)-6-nitroaniline |
|---|---|
| PubChem CID | 62532304 |
| Molecular Formula | C10H12F2N2O4S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2,3-difluoro-N-(3-methylsulfonylpropyl)-6-nitroaniline |
| SMILES | CS(=O)(=O)CCCNc1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C10H12F2N2O4S/c1-19(17,18)6-2-5-13-10-8(14(15)16)4-3-7(11)9(10)12/h3-4,13H,2,5-6H2,1H3 |
| InChIKey | HVWAOQYQWDUZGY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|