C9H11F2N3O4S — CID 55086018
N-[2-(2,3-difluoro-6-nitroanilino)ethyl]methanesulfonamide (PubChem CID 55086018) has the molecular formula C9H11F2N3O4S and a molecular weight of 295.27 g/mol. Its IUPAC name is N-[2-(2,3-difluoro-6-nitroanilino)ethyl]methanesulfonamide.
| Compound Name | N-[2-(2,3-difluoro-6-nitroanilino)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 55086018 |
| Molecular Formula | C9H11F2N3O4S |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-[2-(2,3-difluoro-6-nitroanilino)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C9H11F2N3O4S/c1-19(17,18)13-5-4-12-9-7(14(15)16)3-2-6(10)8(9)11/h2-3,12-13H,4-5H2,1H3 |
| InChIKey | PADHAJPIVNCADU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|