C11H15F2N3O2 — CID 55098004
N-(2,3-difluoro-6-nitrophenyl)-N'-ethyl-N'-methylethane-1,2-diamine (PubChem CID 55098004) has the molecular formula C11H15F2N3O2 and a molecular weight of 259.26 g/mol. Its IUPAC name is N-(2,3-difluoro-6-nitrophenyl)-N'-ethyl-N'-methylethane-1,2-diamine.
| Compound Name | N-(2,3-difluoro-6-nitrophenyl)-N'-ethyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 55098004 |
| Molecular Formula | C11H15F2N3O2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-(2,3-difluoro-6-nitrophenyl)-N'-ethyl-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNc1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C11H15F2N3O2/c1-3-15(2)7-6-14-11-9(16(17)18)5-4-8(12)10(11)13/h4-5,14H,3,6-7H2,1-2H3 |
| InChIKey | UGTMXHUSIMOMLK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|