C11H16FN3O2 — CID 62641440
N'-ethyl-N-(3-fluoro-2-nitrophenyl)-N'-methylethane-1,2-diamine (PubChem CID 62641440) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is N'-ethyl-N-(3-fluoro-2-nitrophenyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N-(3-fluoro-2-nitrophenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62641440 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N'-ethyl-N-(3-fluoro-2-nitrophenyl)-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNc1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16FN3O2/c1-3-14(2)8-7-13-10-6-4-5-9(12)11(10)15(16)17/h4-6,13H,3,7-8H2,1-2H3 |
| InChIKey | KFXSYCMUTHHGCG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|