C11H12FN5O2 — CID 55200757
3-fluoro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-nitroaniline (PubChem CID 55200757) has the molecular formula C11H12FN5O2 and a molecular weight of 265.25 g/mol. Its IUPAC name is 3-fluoro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-nitroaniline.
| Compound Name | 3-fluoro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 55200757 |
| Molecular Formula | C11H12FN5O2 |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-fluoro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-nitroaniline |
| SMILES | Cn1cnnc1CCNc1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12FN5O2/c1-16-7-14-15-10(16)5-6-13-9-4-2-3-8(12)11(9)17(18)19/h2-4,7,13H,5-6H2,1H3 |
| InChIKey | GFKSSYYDMIMVLD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|