C16H18FN3O2 — CID 60578967
N'-(3-fluoro-2-nitrophenyl)-N,N-dimethyl-1-phenylethane-1,2-diamine (PubChem CID 60578967) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is N'-(3-fluoro-2-nitrophenyl)-N,N-dimethyl-1-phenylethane-1,2-diamine.
| Compound Name | N'-(3-fluoro-2-nitrophenyl)-N,N-dimethyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 60578967 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N'-(3-fluoro-2-nitrophenyl)-N,N-dimethyl-1-phenylethane-1,2-diamine |
| SMILES | CN(C)C(CNc1cccc(F)c1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H18FN3O2/c1-19(2)15(12-7-4-3-5-8-12)11-18-14-10-6-9-13(17)16(14)20(21)22/h3-10,15,18H,11H2,1-2H3 |
| InChIKey | FGYSIERBLJYSMW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|