C10H14FN3O3 — CID 64541514
3-amino-4-(3-fluoro-2-nitroanilino)butan-2-ol (PubChem CID 64541514) has the molecular formula C10H14FN3O3 and a molecular weight of 243.24 g/mol. Its IUPAC name is 3-amino-4-(3-fluoro-2-nitroanilino)butan-2-ol.
| Compound Name | 3-amino-4-(3-fluoro-2-nitroanilino)butan-2-ol |
|---|---|
| PubChem CID | 64541514 |
| Molecular Formula | C10H14FN3O3 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-amino-4-(3-fluoro-2-nitroanilino)butan-2-ol |
| SMILES | CC(O)C(N)CNc1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14FN3O3/c1-6(15)8(12)5-13-9-4-2-3-7(11)10(9)14(16)17/h2-4,6,8,13,15H,5,12H2,1H3 |
| InChIKey | BRPXWISZPBAAOO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|