C14H11Cl2FN2O3 — CID 133308203
1-(3,5-dichlorophenyl)-2-(3-fluoro-2-nitroanilino)ethanol (PubChem CID 133308203) has the molecular formula C14H11Cl2FN2O3 and a molecular weight of 345.16 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2-(3-fluoro-2-nitroanilino)ethanol.
| Compound Name | 1-(3,5-dichlorophenyl)-2-(3-fluoro-2-nitroanilino)ethanol |
|---|---|
| PubChem CID | 133308203 |
| Molecular Formula | C14H11Cl2FN2O3 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2-(3-fluoro-2-nitroanilino)ethanol |
| SMILES | O=[N+]([O-])c1c(F)cccc1NCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2FN2O3/c15-9-4-8(5-10(16)6-9)13(20)7-18-12-3-1-2-11(17)14(12)19(21)22/h1-6,13,18,20H,7H2 |
| InChIKey | VCHYMLADRVTNBX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|