C14H13Cl2N3O5S — CID 133308108
2-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-5-nitrobenzenesulfonamide (PubChem CID 133308108) has the molecular formula C14H13Cl2N3O5S and a molecular weight of 406.25 g/mol. Its IUPAC name is 2-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-5-nitrobenzenesulfonamide.
| Compound Name | 2-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133308108 |
| Molecular Formula | C14H13Cl2N3O5S |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 2-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-5-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1NCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N3O5S/c15-9-3-8(4-10(16)5-9)13(20)7-18-12-2-1-11(19(21)22)6-14(12)25(17,23)24/h1-6,13,18,20H,7H2,(H2,17,23,24) |
| InChIKey | IRSXGETWBBEXSC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|