C14H14ClN3O5S — CID 55377873
2-[2-(4-chlorophenoxy)ethylamino]-5-nitrobenzenesulfonamide (PubChem CID 55377873) has the molecular formula C14H14ClN3O5S and a molecular weight of 371.80 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethylamino]-5-nitrobenzenesulfonamide.
| Compound Name | 2-[2-(4-chlorophenoxy)ethylamino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55377873 |
| Molecular Formula | C14H14ClN3O5S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethylamino]-5-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClN3O5S/c15-10-1-4-12(5-2-10)23-8-7-17-13-6-3-11(18(19)20)9-14(13)24(16,21)22/h1-6,9,17H,7-8H2,(H2,16,21,22) |
| InChIKey | GDHCVGJVFGPHJG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|