C14H13F2N3O5S — CID 133291767
3-[2-(3,4-difluorophenoxy)ethylamino]-5-nitrobenzenesulfonamide (PubChem CID 133291767) has the molecular formula C14H13F2N3O5S and a molecular weight of 373.34 g/mol. Its IUPAC name is 3-[2-(3,4-difluorophenoxy)ethylamino]-5-nitrobenzenesulfonamide.
| Compound Name | 3-[2-(3,4-difluorophenoxy)ethylamino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133291767 |
| Molecular Formula | C14H13F2N3O5S |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 3-[2-(3,4-difluorophenoxy)ethylamino]-5-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(NCCOc2ccc(F)c(F)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13F2N3O5S/c15-13-2-1-11(8-14(13)16)24-4-3-18-9-5-10(19(20)21)7-12(6-9)25(17,22)23/h1-2,5-8,18H,3-4H2,(H2,17,22,23) |
| InChIKey | FSQZBIGXRDPINA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|