C16H17N3O4S2 — CID 133296877
3-nitro-5-[(1-phenylsulfanylcyclopropyl)methylamino]benzenesulfonamide (PubChem CID 133296877) has the molecular formula C16H17N3O4S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-nitro-5-[(1-phenylsulfanylcyclopropyl)methylamino]benzenesulfonamide.
| Compound Name | 3-nitro-5-[(1-phenylsulfanylcyclopropyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 133296877 |
| Molecular Formula | C16H17N3O4S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-nitro-5-[(1-phenylsulfanylcyclopropyl)methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(NCC2(Sc3ccccc3)CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17N3O4S2/c17-25(22,23)15-9-12(8-13(10-15)19(20)21)18-11-16(6-7-16)24-14-4-2-1-3-5-14/h1-5,8-10,18H,6-7,11H2,(H2,17,22,23) |
| InChIKey | WCJVWTHZNSEWRP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|