C14H18N6O4S — CID 133382873
3-nitro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)benzenesulfonamide (PubChem CID 133382873) has the molecular formula C14H18N6O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is 3-nitro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)benzenesulfonamide.
| Compound Name | 3-nitro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 133382873 |
| Molecular Formula | C14H18N6O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 3-nitro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(NCc2nnc3n2CCCCC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N6O4S/c15-25(23,24)12-7-10(6-11(8-12)20(21)22)16-9-14-18-17-13-4-2-1-3-5-19(13)14/h6-8,16H,1-5,9H2,(H2,15,23,24) |
| InChIKey | IMHUMWUHSNQYRT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|