C19H20F2N6O2S — CID 133382878
N-(3,4-difluorophenyl)-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)pyridine-3-sulfonamide (PubChem CID 133382878) has the molecular formula C19H20F2N6O2S and a molecular weight of 434.47 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)pyridine-3-sulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133382878 |
| Molecular Formula | C19H20F2N6O2S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1)c1ccc(NCc2nnc3n2CCCCC3)nc1 |
| InChI | InChI=1S/C19H20F2N6O2S/c20-15-7-5-13(10-16(15)21)26-30(28,29)14-6-8-17(22-11-14)23-12-19-25-24-18-4-2-1-3-9-27(18)19/h5-8,10-11,26H,1-4,9,12H2,(H,22,23) |
| InChIKey | KKFHYOZMCGRUER-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |