C18H19F2N3O3S — CID 133390354
N-(3,4-difluorophenyl)-6-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]pyridine-3-sulfonamide (PubChem CID 133390354) has the molecular formula C18H19F2N3O3S and a molecular weight of 395.43 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]pyridine-3-sulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-6-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133390354 |
| Molecular Formula | C18H19F2N3O3S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1)c1ccc(NCCC2=CCOCC2)nc1 |
| InChI | InChI=1S/C18H19F2N3O3S/c19-16-3-1-14(11-17(16)20)23-27(24,25)15-2-4-18(22-12-15)21-8-5-13-6-9-26-10-7-13/h1-4,6,11-12,23H,5,7-10H2,(H,21,22) |
| InChIKey | DACFKFPNOCKEOW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|